C11H18N2O — CID 130542259
4-N-ethyl-2-methoxy-4-N,5-dimethylbenzene-1,4-diamine (PubChem CID 130542259) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 4-N-ethyl-2-methoxy-4-N,5-dimethylbenzene-1,4-diamine.
| Compound Name | 4-N-ethyl-2-methoxy-4-N,5-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 130542259 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 4-N-ethyl-2-methoxy-4-N,5-dimethylbenzene-1,4-diamine |
| SMILES | CCN(C)c1cc(OC)c(N)cc1C |
| InChI | InChI=1S/C11H18N2O/c1-5-13(3)10-7-11(14-4)9(12)6-8(10)2/h6-7H,5,12H2,1-4H3 |
| InChIKey | IQMIQACJGMIJMV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|