C13H21NO2 — CID 115259380
N-ethyl-2,5-dimethoxy-N,3,4-trimethylaniline (PubChem CID 115259380) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is N-ethyl-2,5-dimethoxy-N,3,4-trimethylaniline.
| Compound Name | N-ethyl-2,5-dimethoxy-N,3,4-trimethylaniline |
|---|---|
| PubChem CID | 115259380 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | N-ethyl-2,5-dimethoxy-N,3,4-trimethylaniline |
| SMILES | CCN(C)c1cc(OC)c(C)c(C)c1OC |
| InChI | InChI=1S/C13H21NO2/c1-7-14(4)11-8-12(15-5)9(2)10(3)13(11)16-6/h8H,7H2,1-6H3 |
| InChIKey | UAXVVHPEIHJGAD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |