C13H21NO — CID 115259374
N-ethyl-2-methoxy-N,3,4,6-tetramethylaniline (PubChem CID 115259374) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is N-ethyl-2-methoxy-N,3,4,6-tetramethylaniline.
| Compound Name | N-ethyl-2-methoxy-N,3,4,6-tetramethylaniline |
|---|---|
| PubChem CID | 115259374 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | N-ethyl-2-methoxy-N,3,4,6-tetramethylaniline |
| SMILES | CCN(C)c1c(C)cc(C)c(C)c1OC |
| InChI | InChI=1S/C13H21NO/c1-7-14(5)12-10(3)8-9(2)11(4)13(12)15-6/h8H,7H2,1-6H3 |
| InChIKey | IIKALDRIGACHCS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |