C10H16N2O — CID 172575945
N-ethyl-3-methoxy-N,4-dimethylpyridin-2-amine (PubChem CID 172575945) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is N-ethyl-3-methoxy-N,4-dimethylpyridin-2-amine.
| Compound Name | N-ethyl-3-methoxy-N,4-dimethylpyridin-2-amine |
|---|---|
| PubChem CID | 172575945 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | N-ethyl-3-methoxy-N,4-dimethylpyridin-2-amine |
| SMILES | CCN(C)c1nccc(C)c1OC |
| InChI | InChI=1S/C10H16N2O/c1-5-12(3)10-9(13-4)8(2)6-7-11-10/h6-7H,5H2,1-4H3 |
| InChIKey | UCNCKQINQOMSGW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |