C10H15BrN2 — CID 106876527
3-bromo-N,N-diethyl-4-methylpyridin-2-amine (PubChem CID 106876527) has the molecular formula C10H15BrN2 and a molecular weight of 243.15 g/mol. Its IUPAC name is 3-bromo-N,N-diethyl-4-methylpyridin-2-amine.
| Compound Name | 3-bromo-N,N-diethyl-4-methylpyridin-2-amine |
|---|---|
| PubChem CID | 106876527 |
| Molecular Formula | C10H15BrN2 |
| Molecular Weight | 243.15 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 3-bromo-N,N-diethyl-4-methylpyridin-2-amine |
| SMILES | CCN(CC)c1nccc(C)c1Br |
| InChI | InChI=1S/C10H15BrN2/c1-4-13(5-2)10-9(11)8(3)6-7-12-10/h6-7H,4-5H2,1-3H3 |
| InChIKey | IIHSQUSGPLNYKJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.15 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |