C9H13BrN2 — CID 61374664
3-bromo-N,N-diethylpyridin-2-amine (PubChem CID 61374664) has the molecular formula C9H13BrN2 and a molecular weight of 229.12 g/mol. Its IUPAC name is 3-bromo-N,N-diethylpyridin-2-amine.
| Compound Name | 3-bromo-N,N-diethylpyridin-2-amine |
|---|---|
| PubChem CID | 61374664 |
| Molecular Formula | C9H13BrN2 |
| Molecular Weight | 229.12 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | 3-bromo-N,N-diethylpyridin-2-amine |
| SMILES | CCN(CC)c1ncccc1Br |
| InChI | InChI=1S/C9H13BrN2/c1-3-12(4-2)9-8(10)6-5-7-11-9/h5-7H,3-4H2,1-2H3 |
| InChIKey | XOYWQNPWRSICPS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.12 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |