About 3-bromo-N,N-diethylpyridin-2-amine
3-bromo-N,N-diethylpyridin-2-amine (PubChem CID 61374664) has the molecular formula C9H13BrN2
and a molecular weight of 229.12 g/mol. Its IUPAC name is 3-bromo-N,N-diethylpyridin-2-amine.
Molecular Properties
| Compound Name | 3-bromo-N,N-diethylpyridin-2-amine |
| PubChem CID | 61374664 |
| Molecular Formula | C9H13BrN2 |
| Molecular Weight | 229.12 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | 3-bromo-N,N-diethylpyridin-2-amine |
| SMILES | CCN(CC)c1ncccc1Br |
| InChI | InChI=1S/C9H13BrN2/c1-3-12(4-2)9-8(10)6-5-7-11-9/h5-7H,3-4H2,1-2H3 |
| InChIKey | XOYWQNPWRSICPS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.12 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-N,N-diethylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N,N-diethylpyridin-2-amine?
The IUPAC name of 3-bromo-N,N-diethylpyridin-2-amine (CID 61374664) is 3-bromo-N,N-diethylpyridin-2-amine.
What is the SMILES notation for 3-bromo-N,N-diethylpyridin-2-amine?
The canonical SMILES for 3-bromo-N,N-diethylpyridin-2-amine is CCN(CC)c1ncccc1Br.
What is the InChIKey of 3-bromo-N,N-diethylpyridin-2-amine?
The InChIKey is XOYWQNPWRSICPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13BrN2/c1-3-12(4-2)9-8(10)6-5-7-11-9/h5-7H,3-4H2,1-2H3.
What are the key properties of 3-bromo-N,N-diethylpyridin-2-amine?
3-bromo-N,N-diethylpyridin-2-amine has a molecular weight of 229.12 g/mol, XLogP of 2.69, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N,N-diethylpyridin-2-amine is sourced from PubChem (CID 61374664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).