C11H18N2O2S — CID 117062133
N,N-diethyl-3-ethylsulfonylpyridin-2-amine (PubChem CID 117062133) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is N,N-diethyl-3-ethylsulfonylpyridin-2-amine.
| Compound Name | N,N-diethyl-3-ethylsulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 117062133 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | N,N-diethyl-3-ethylsulfonylpyridin-2-amine |
| SMILES | CCN(CC)c1ncccc1S(=O)(=O)CC |
| InChI | InChI=1S/C11H18N2O2S/c1-4-13(5-2)11-10(8-7-9-12-11)16(14,15)6-3/h7-9H,4-6H2,1-3H3 |
| InChIKey | ZQRRWBNSDBCKAD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |