C9H9Br2F3N2 — CID 107490411
3-bromo-N-(2-bromoethyl)-N-(2,2,2-trifluoroethyl)pyridin-2-amine (PubChem CID 107490411) has the molecular formula C9H9Br2F3N2 and a molecular weight of 361.99 g/mol. Its IUPAC name is 3-bromo-N-(2-bromoethyl)-N-(2,2,2-trifluoroethyl)pyridin-2-amine.
| Compound Name | 3-bromo-N-(2-bromoethyl)-N-(2,2,2-trifluoroethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 107490411 |
| Molecular Formula | C9H9Br2F3N2 |
| Molecular Weight | 361.99 g/mol |
| Exact Mass | 359.91 |
| IUPAC Name | 3-bromo-N-(2-bromoethyl)-N-(2,2,2-trifluoroethyl)pyridin-2-amine |
| SMILES | FC(F)(F)CN(CCBr)c1ncccc1Br |
| InChI | InChI=1S/C9H9Br2F3N2/c10-3-5-16(6-9(12,13)14)8-7(11)2-1-4-15-8/h1-2,4H,3,5-6H2 |
| InChIKey | PFEDKAJYKPWSKD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.99 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|