C9H8BrF5N2 — CID 107490362
N-(2-bromoethyl)-3,5-difluoro-N-(2,2,2-trifluoroethyl)pyridin-2-amine (PubChem CID 107490362) has the molecular formula C9H8BrF5N2 and a molecular weight of 319.07 g/mol. Its IUPAC name is N-(2-bromoethyl)-3,5-difluoro-N-(2,2,2-trifluoroethyl)pyridin-2-amine.
| Compound Name | N-(2-bromoethyl)-3,5-difluoro-N-(2,2,2-trifluoroethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 107490362 |
| Molecular Formula | C9H8BrF5N2 |
| Molecular Weight | 319.07 g/mol |
| Exact Mass | 317.98 |
| IUPAC Name | N-(2-bromoethyl)-3,5-difluoro-N-(2,2,2-trifluoroethyl)pyridin-2-amine |
| SMILES | Fc1cnc(N(CCBr)CC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C9H8BrF5N2/c10-1-2-17(5-9(13,14)15)8-7(12)3-6(11)4-16-8/h3-4H,1-2,5H2 |
| InChIKey | YQKIMWRTIWEEID-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.07 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|