C11H17F2N3 — CID 112676470
N'-(3,5-difluoro-2-pyridinyl)-N'-methyl-N-propylethane-1,2-diamine (PubChem CID 112676470) has the molecular formula C11H17F2N3 and a molecular weight of 229.27 g/mol. Its IUPAC name is N'-(3,5-difluoro-2-pyridinyl)-N'-methyl-N-propylethane-1,2-diamine.
| Compound Name | N'-(3,5-difluoro-2-pyridinyl)-N'-methyl-N-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 112676470 |
| Molecular Formula | C11H17F2N3 |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | N'-(3,5-difluoro-2-pyridinyl)-N'-methyl-N-propylethane-1,2-diamine |
| SMILES | CCCNCCN(C)c1ncc(F)cc1F |
| InChI | InChI=1S/C11H17F2N3/c1-3-4-14-5-6-16(2)11-10(13)7-9(12)8-15-11/h7-8,14H,3-6H2,1-2H3 |
| InChIKey | ISHQUNXFNBTTLE-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|