About N'-furo[3,2-c]pyridin-4-yl-N'-methyl-N-propylethane-1,2-diamine
N'-furo[3,2-c]pyridin-4-yl-N'-methyl-N-propylethane-1,2-diamine (PubChem CID 106535582) has the molecular formula C13H19N3O
and a molecular weight of 233.31 g/mol. Its IUPAC name is N'-furo[3,2-c]pyridin-4-yl-N'-methyl-N-propylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-furo[3,2-c]pyridin-4-yl-N'-methyl-N-propylethane-1,2-diamine |
| PubChem CID | 106535582 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | N'-furo[3,2-c]pyridin-4-yl-N'-methyl-N-propylethane-1,2-diamine |
| SMILES | CCCNCCN(C)c1nccc2occc12 |
| InChI | InChI=1S/C13H19N3O/c1-3-6-14-8-9-16(2)13-11-5-10-17-12(11)4-7-15-13/h4-5,7,10,14H,3,6,8-9H2,1-2H3 |
| InChIKey | LAKCKONTMVIQPA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-furo[3,2-c]pyridin-4-yl-N'-methyl-N-propylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-furo[3,2-c]pyridin-4-yl-N'-methyl-N-propylethane-1,2-diamine?
The IUPAC name of N'-furo[3,2-c]pyridin-4-yl-N'-methyl-N-propylethane-1,2-diamine (CID 106535582) is N'-furo[3,2-c]pyridin-4-yl-N'-methyl-N-propylethane-1,2-diamine.
What is the SMILES notation for N'-furo[3,2-c]pyridin-4-yl-N'-methyl-N-propylethane-1,2-diamine?
The canonical SMILES for N'-furo[3,2-c]pyridin-4-yl-N'-methyl-N-propylethane-1,2-diamine is CCCNCCN(C)c1nccc2occc12.
What is the InChIKey of N'-furo[3,2-c]pyridin-4-yl-N'-methyl-N-propylethane-1,2-diamine?
The InChIKey is LAKCKONTMVIQPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O/c1-3-6-14-8-9-16(2)13-11-5-10-17-12(11)4-7-15-13/h4-5,7,10,14H,3,6,8-9H2,1-2H3.
What are the key properties of N'-furo[3,2-c]pyridin-4-yl-N'-methyl-N-propylethane-1,2-diamine?
N'-furo[3,2-c]pyridin-4-yl-N'-methyl-N-propylethane-1,2-diamine has a molecular weight of 233.31 g/mol, XLogP of 2.26, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-furo[3,2-c]pyridin-4-yl-N'-methyl-N-propylethane-1,2-diamine is sourced from PubChem (CID 106535582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).