C13H19N3O — CID 106535582
N'-furo[3,2-c]pyridin-4-yl-N'-methyl-N-propylethane-1,2-diamine (PubChem CID 106535582) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is N'-furo[3,2-c]pyridin-4-yl-N'-methyl-N-propylethane-1,2-diamine.
| Compound Name | N'-furo[3,2-c]pyridin-4-yl-N'-methyl-N-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 106535582 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | N'-furo[3,2-c]pyridin-4-yl-N'-methyl-N-propylethane-1,2-diamine |
| SMILES | CCCNCCN(C)c1nccc2occc12 |
| InChI | InChI=1S/C13H19N3O/c1-3-6-14-8-9-16(2)13-11-5-10-17-12(11)4-7-15-13/h4-5,7,10,14H,3,6,8-9H2,1-2H3 |
| InChIKey | LAKCKONTMVIQPA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|