C11H13ClN2O — CID 106535724
N-(1-chloropropan-2-yl)-N-methylfuro[3,2-c]pyridin-4-amine (PubChem CID 106535724) has the molecular formula C11H13ClN2O and a molecular weight of 224.69 g/mol. Its IUPAC name is N-(1-chloropropan-2-yl)-N-methylfuro[3,2-c]pyridin-4-amine.
| Compound Name | N-(1-chloropropan-2-yl)-N-methylfuro[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 106535724 |
| Molecular Formula | C11H13ClN2O |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | N-(1-chloropropan-2-yl)-N-methylfuro[3,2-c]pyridin-4-amine |
| SMILES | CC(CCl)N(C)c1nccc2occc12 |
| InChI | InChI=1S/C11H13ClN2O/c1-8(7-12)14(2)11-9-4-6-15-10(9)3-5-13-11/h3-6,8H,7H2,1-2H3 |
| InChIKey | FBEKYIQYKOXCJZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|