C9H10ClNO — CID 144953720
4-chlorofuro[3,2-c]pyridine;ethane (PubChem CID 144953720) has the molecular formula C9H10ClNO and a molecular weight of 183.64 g/mol. Its IUPAC name is 4-chlorofuro[3,2-c]pyridine;ethane.
| Compound Name | 4-chlorofuro[3,2-c]pyridine;ethane |
|---|---|
| PubChem CID | 144953720 |
| Molecular Formula | C9H10ClNO |
| Molecular Weight | 183.64 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 4-chlorofuro[3,2-c]pyridine;ethane |
| SMILES | CC.Clc1nccc2occc12 |
| InChI | InChI=1S/C7H4ClNO.C2H6/c8-7-5-2-4-10-6(5)1-3-9-7;1-2/h1-4H;1-2H3 |
| InChIKey | UUHQUIGWLAMKDF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.64 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|