C11H14N2O2 — CID 103873021
2-[furo[3,2-c]pyridin-4-yl(methyl)amino]propan-1-ol (PubChem CID 103873021) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 2-[furo[3,2-c]pyridin-4-yl(methyl)amino]propan-1-ol.
| Compound Name | 2-[furo[3,2-c]pyridin-4-yl(methyl)amino]propan-1-ol |
|---|---|
| PubChem CID | 103873021 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 2-[furo[3,2-c]pyridin-4-yl(methyl)amino]propan-1-ol |
| SMILES | CC(CO)N(C)c1nccc2occc12 |
| InChI | InChI=1S/C11H14N2O2/c1-8(7-14)13(2)11-9-4-6-15-10(9)3-5-12-11/h3-6,8,14H,7H2,1-2H3 |
| InChIKey | BELZCUYKEOKXGM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |