C10H12N2O2 — CID 103729109
2-(furo[3,2-c]pyridin-4-ylamino)propan-1-ol (PubChem CID 103729109) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 2-(furo[3,2-c]pyridin-4-ylamino)propan-1-ol.
| Compound Name | 2-(furo[3,2-c]pyridin-4-ylamino)propan-1-ol |
|---|---|
| PubChem CID | 103729109 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 2-(furo[3,2-c]pyridin-4-ylamino)propan-1-ol |
| SMILES | CC(CO)Nc1nccc2occc12 |
| InChI | InChI=1S/C10H12N2O2/c1-7(6-13)12-10-8-3-5-14-9(8)2-4-11-10/h2-5,7,13H,6H2,1H3,(H,11,12) |
| InChIKey | KOXZIPUWXVZIJO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |