C11H12N2O — CID 103750018
N-but-3-en-2-ylfuro[3,2-c]pyridin-4-amine (PubChem CID 103750018) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is N-but-3-en-2-ylfuro[3,2-c]pyridin-4-amine.
| Compound Name | N-but-3-en-2-ylfuro[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 103750018 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | N-but-3-en-2-ylfuro[3,2-c]pyridin-4-amine |
| SMILES | C=CC(C)Nc1nccc2occc12 |
| InChI | InChI=1S/C11H12N2O/c1-3-8(2)13-11-9-5-7-14-10(9)4-6-12-11/h3-8H,1H2,2H3,(H,12,13) |
| InChIKey | FSUFFKJSEXHSQM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|