C12H16N2O2 — CID 103703374
3-(furo[3,2-c]pyridin-4-ylamino)pentan-1-ol (PubChem CID 103703374) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 3-(furo[3,2-c]pyridin-4-ylamino)pentan-1-ol.
| Compound Name | 3-(furo[3,2-c]pyridin-4-ylamino)pentan-1-ol |
|---|---|
| PubChem CID | 103703374 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 3-(furo[3,2-c]pyridin-4-ylamino)pentan-1-ol |
| SMILES | CCC(CCO)Nc1nccc2occc12 |
| InChI | InChI=1S/C12H16N2O2/c1-2-9(4-7-15)14-12-10-5-8-16-11(10)3-6-13-12/h3,5-6,8-9,15H,2,4,7H2,1H3,(H,13,14) |
| InChIKey | LCHYDTXOXHSSFY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |