C12H17N3O2 — CID 106154838
3-N-furo[3,2-c]pyridin-4-yl-4-methoxybutane-1,3-diamine (PubChem CID 106154838) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 3-N-furo[3,2-c]pyridin-4-yl-4-methoxybutane-1,3-diamine.
| Compound Name | 3-N-furo[3,2-c]pyridin-4-yl-4-methoxybutane-1,3-diamine |
|---|---|
| PubChem CID | 106154838 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 3-N-furo[3,2-c]pyridin-4-yl-4-methoxybutane-1,3-diamine |
| SMILES | COCC(CCN)Nc1nccc2occc12 |
| InChI | InChI=1S/C12H17N3O2/c1-16-8-9(2-5-13)15-12-10-4-7-17-11(10)3-6-14-12/h3-4,6-7,9H,2,5,8,13H2,1H3,(H,14,15) |
| InChIKey | AWSYAXUYSFFBFK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 73.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |