C11H15N3O2 — CID 106535766
N-[2-(2-aminoethoxy)ethyl]furo[3,2-c]pyridin-4-amine (PubChem CID 106535766) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is N-[2-(2-aminoethoxy)ethyl]furo[3,2-c]pyridin-4-amine.
| Compound Name | N-[2-(2-aminoethoxy)ethyl]furo[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 106535766 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | N-[2-(2-aminoethoxy)ethyl]furo[3,2-c]pyridin-4-amine |
| SMILES | NCCOCCNc1nccc2occc12 |
| InChI | InChI=1S/C11H15N3O2/c12-3-7-15-8-5-14-11-9-2-6-16-10(9)1-4-13-11/h1-2,4,6H,3,5,7-8,12H2,(H,13,14) |
| InChIKey | QVMLROBDMYDZNE-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 73.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|