C10H12N2O2 — CID 90356822
N-(2-methoxyethyl)furo[3,2-c]pyridin-4-amine (PubChem CID 90356822) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is N-(2-methoxyethyl)furo[3,2-c]pyridin-4-amine.
| Compound Name | N-(2-methoxyethyl)furo[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 90356822 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | N-(2-methoxyethyl)furo[3,2-c]pyridin-4-amine |
| SMILES | COCCNc1nccc2occc12 |
| InChI | InChI=1S/C10H12N2O2/c1-13-7-5-12-10-8-3-6-14-9(8)2-4-11-10/h2-4,6H,5,7H2,1H3,(H,11,12) |
| InChIKey | PMMZJFUVSZFHFV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|