C11H12N2O4 — CID 106534922
2-[2-(furo[3,2-c]pyridin-4-ylamino)ethoxy]acetic acid (PubChem CID 106534922) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is 2-[2-(furo[3,2-c]pyridin-4-ylamino)ethoxy]acetic acid.
| Compound Name | 2-[2-(furo[3,2-c]pyridin-4-ylamino)ethoxy]acetic acid |
|---|---|
| PubChem CID | 106534922 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 2-[2-(furo[3,2-c]pyridin-4-ylamino)ethoxy]acetic acid |
| SMILES | O=C(O)COCCNc1nccc2occc12 |
| InChI | InChI=1S/C11H12N2O4/c14-10(15)7-16-6-4-13-11-8-2-5-17-9(8)1-3-12-11/h1-3,5H,4,6-7H2,(H,12,13)(H,14,15) |
| InChIKey | XIWFRLUMBDZGFV-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|