2-[2-(furo[3,2-c]pyridin-4-ylamino)ethoxy]acetic acid

C11H12N2O4 — CID 106534922

IUPAC2-[2-(furo[3,2-c]pyridin-4-ylamino)ethoxy]acetic acid
SMILESO=C(O)COCCNc1nccc2occc12
InChIInChI=1S/C11H12N2O4/c14-10(15)7-16-6-4-13-11-8-2-5-17-9(8)1-3-12-11/h1-3,5H,4,6-7H2,(H,12,13)(H,14,15)
InChIKeyXIWFRLUMBDZGFV-UHFFFAOYSA-N
MW236.23 g/mol
LogP1.34
Rot. Bonds6

About 2-[2-(furo[3,2-c]pyridin-4-ylamino)ethoxy]acetic acid

2-[2-(furo[3,2-c]pyridin-4-ylamino)ethoxy]acetic acid (PubChem CID 106534922) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is 2-[2-(furo[3,2-c]pyridin-4-ylamino)ethoxy]acetic acid.

Molecular Properties

Compound Name2-[2-(furo[3,2-c]pyridin-4-ylamino)ethoxy]acetic acid
PubChem CID106534922
Molecular FormulaC11H12N2O4
Molecular Weight236.23 g/mol
Exact Mass236.08
IUPAC Name2-[2-(furo[3,2-c]pyridin-4-ylamino)ethoxy]acetic acid
SMILESO=C(O)COCCNc1nccc2occc12
InChIInChI=1S/C11H12N2O4/c14-10(15)7-16-6-4-13-11-8-2-5-17-9(8)1-3-12-11/h1-3,5H,4,6-7H2,(H,12,13)(H,14,15)
InChIKeyXIWFRLUMBDZGFV-UHFFFAOYSA-N
XLogP1.34
TPSA84.59 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.23
LogP ≤ 51.34
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-[2-(furo[3,2-c]pyridin-4-ylamino)ethoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(furo[3,2-c]pyridin-4-ylamino)ethoxy]acetic acid?
The IUPAC name of 2-[2-(furo[3,2-c]pyridin-4-ylamino)ethoxy]acetic acid (CID 106534922) is 2-[2-(furo[3,2-c]pyridin-4-ylamino)ethoxy]acetic acid.
What is the SMILES notation for 2-[2-(furo[3,2-c]pyridin-4-ylamino)ethoxy]acetic acid?
The canonical SMILES for 2-[2-(furo[3,2-c]pyridin-4-ylamino)ethoxy]acetic acid is O=C(O)COCCNc1nccc2occc12.
What is the InChIKey of 2-[2-(furo[3,2-c]pyridin-4-ylamino)ethoxy]acetic acid?
The InChIKey is XIWFRLUMBDZGFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O4/c14-10(15)7-16-6-4-13-11-8-2-5-17-9(8)1-3-12-11/h1-3,5H,4,6-7H2,(H,12,13)(H,14,15).
What are the key properties of 2-[2-(furo[3,2-c]pyridin-4-ylamino)ethoxy]acetic acid?
2-[2-(furo[3,2-c]pyridin-4-ylamino)ethoxy]acetic acid has a molecular weight of 236.23 g/mol, XLogP of 1.34, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(furo[3,2-c]pyridin-4-ylamino)ethoxy]acetic acid is sourced from PubChem (CID 106534922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).