C10H9BrN2O — CID 103702761
N-(2-bromoprop-2-enyl)furo[3,2-c]pyridin-4-amine (PubChem CID 103702761) has the molecular formula C10H9BrN2O and a molecular weight of 253.10 g/mol. Its IUPAC name is N-(2-bromoprop-2-enyl)furo[3,2-c]pyridin-4-amine.
| Compound Name | N-(2-bromoprop-2-enyl)furo[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 103702761 |
| Molecular Formula | C10H9BrN2O |
| Molecular Weight | 253.10 g/mol |
| Exact Mass | 251.99 |
| IUPAC Name | N-(2-bromoprop-2-enyl)furo[3,2-c]pyridin-4-amine |
| SMILES | C=C(Br)CNc1nccc2occc12 |
| InChI | InChI=1S/C10H9BrN2O/c1-7(11)6-13-10-8-3-5-14-9(8)2-4-12-10/h2-5H,1,6H2,(H,12,13) |
| InChIKey | BWVOOUNAXOBBEI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.10 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |