C12H14N2O2 — CID 103718464
1-[(furo[3,2-c]pyridin-4-ylamino)methyl]cyclobutan-1-ol (PubChem CID 103718464) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 1-[(furo[3,2-c]pyridin-4-ylamino)methyl]cyclobutan-1-ol.
| Compound Name | 1-[(furo[3,2-c]pyridin-4-ylamino)methyl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 103718464 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 1-[(furo[3,2-c]pyridin-4-ylamino)methyl]cyclobutan-1-ol |
| SMILES | OC1(CNc2nccc3occc23)CCC1 |
| InChI | InChI=1S/C12H14N2O2/c15-12(4-1-5-12)8-14-11-9-3-7-16-10(9)2-6-13-11/h2-3,6-7,15H,1,4-5,8H2,(H,13,14) |
| InChIKey | FTOAYEZCHWMBCY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |