C13H18N2O2 — CID 103705336
4-(furo[3,2-c]pyridin-4-ylamino)-3,3-dimethylbutan-1-ol (PubChem CID 103705336) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 4-(furo[3,2-c]pyridin-4-ylamino)-3,3-dimethylbutan-1-ol.
| Compound Name | 4-(furo[3,2-c]pyridin-4-ylamino)-3,3-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 103705336 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 4-(furo[3,2-c]pyridin-4-ylamino)-3,3-dimethylbutan-1-ol |
| SMILES | CC(C)(CCO)CNc1nccc2occc12 |
| InChI | InChI=1S/C13H18N2O2/c1-13(2,5-7-16)9-15-12-10-4-8-17-11(10)3-6-14-12/h3-4,6,8,16H,5,7,9H2,1-2H3,(H,14,15) |
| InChIKey | OXFWVPQUPJCNTJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |