C14H20N2OS — CID 103704680
N-(2-ethyl-2-methylsulfanylbutyl)furo[3,2-c]pyridin-4-amine (PubChem CID 103704680) has the molecular formula C14H20N2OS and a molecular weight of 264.39 g/mol. Its IUPAC name is N-(2-ethyl-2-methylsulfanylbutyl)furo[3,2-c]pyridin-4-amine.
| Compound Name | N-(2-ethyl-2-methylsulfanylbutyl)furo[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 103704680 |
| Molecular Formula | C14H20N2OS |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | N-(2-ethyl-2-methylsulfanylbutyl)furo[3,2-c]pyridin-4-amine |
| SMILES | CCC(CC)(CNc1nccc2occc12)SC |
| InChI | InChI=1S/C14H20N2OS/c1-4-14(5-2,18-3)10-16-13-11-7-9-17-12(11)6-8-15-13/h6-9H,4-5,10H2,1-3H3,(H,15,16) |
| InChIKey | HORGDHZUWJXKNL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |