About N-[(3-methyl-1,2-oxazol-5-yl)methyl]furo[3,2-c]pyridin-4-amine
N-[(3-methyl-1,2-oxazol-5-yl)methyl]furo[3,2-c]pyridin-4-amine (PubChem CID 103702757) has the molecular formula C12H11N3O2
and a molecular weight of 229.24 g/mol. Its IUPAC name is N-[(3-methyl-1,2-oxazol-5-yl)methyl]furo[3,2-c]pyridin-4-amine.
Molecular Properties
| Compound Name | N-[(3-methyl-1,2-oxazol-5-yl)methyl]furo[3,2-c]pyridin-4-amine |
| PubChem CID | 103702757 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | N-[(3-methyl-1,2-oxazol-5-yl)methyl]furo[3,2-c]pyridin-4-amine |
| SMILES | Cc1cc(CNc2nccc3occc23)on1 |
| InChI | InChI=1S/C12H11N3O2/c1-8-6-9(17-15-8)7-14-12-10-3-5-16-11(10)2-4-13-12/h2-6H,7H2,1H3,(H,13,14) |
| InChIKey | MBRFZKFVENBPMH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(3-methyl-1,2-oxazol-5-yl)methyl]furo[3,2-c]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-methyl-1,2-oxazol-5-yl)methyl]furo[3,2-c]pyridin-4-amine?
The IUPAC name of N-[(3-methyl-1,2-oxazol-5-yl)methyl]furo[3,2-c]pyridin-4-amine (CID 103702757) is N-[(3-methyl-1,2-oxazol-5-yl)methyl]furo[3,2-c]pyridin-4-amine.
What is the SMILES notation for N-[(3-methyl-1,2-oxazol-5-yl)methyl]furo[3,2-c]pyridin-4-amine?
The canonical SMILES for N-[(3-methyl-1,2-oxazol-5-yl)methyl]furo[3,2-c]pyridin-4-amine is Cc1cc(CNc2nccc3occc23)on1.
What is the InChIKey of N-[(3-methyl-1,2-oxazol-5-yl)methyl]furo[3,2-c]pyridin-4-amine?
The InChIKey is MBRFZKFVENBPMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O2/c1-8-6-9(17-15-8)7-14-12-10-3-5-16-11(10)2-4-13-12/h2-6H,7H2,1H3,(H,13,14).
What are the key properties of N-[(3-methyl-1,2-oxazol-5-yl)methyl]furo[3,2-c]pyridin-4-amine?
N-[(3-methyl-1,2-oxazol-5-yl)methyl]furo[3,2-c]pyridin-4-amine has a molecular weight of 229.24 g/mol, XLogP of 2.74, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-methyl-1,2-oxazol-5-yl)methyl]furo[3,2-c]pyridin-4-amine is sourced from PubChem (CID 103702757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).