C14H10BrFN2O — CID 103702617
N-[(5-bromo-2-fluorophenyl)methyl]furo[3,2-c]pyridin-4-amine (PubChem CID 103702617) has the molecular formula C14H10BrFN2O and a molecular weight of 321.15 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]furo[3,2-c]pyridin-4-amine.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]furo[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 103702617 |
| Molecular Formula | C14H10BrFN2O |
| Molecular Weight | 321.15 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]furo[3,2-c]pyridin-4-amine |
| SMILES | Fc1ccc(Br)cc1CNc1nccc2occc12 |
| InChI | InChI=1S/C14H10BrFN2O/c15-10-1-2-12(16)9(7-10)8-18-14-11-4-6-19-13(11)3-5-17-14/h1-7H,8H2,(H,17,18) |
| InChIKey | WKKJDCNUGWAPGT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.15 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |