C10H13N3O — CID 106535052
N'-furo[3,2-c]pyridin-4-ylpropane-1,3-diamine (PubChem CID 106535052) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is N'-furo[3,2-c]pyridin-4-ylpropane-1,3-diamine.
| Compound Name | N'-furo[3,2-c]pyridin-4-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 106535052 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | N'-furo[3,2-c]pyridin-4-ylpropane-1,3-diamine |
| SMILES | NCCCNc1nccc2occc12 |
| InChI | InChI=1S/C10H13N3O/c11-4-1-5-12-10-8-3-7-14-9(8)2-6-13-10/h2-3,6-7H,1,4-5,11H2,(H,12,13) |
| InChIKey | DNLXGGLKTRWDBD-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|