C15H20N2O — CID 103702592
N-(3-cyclopentylpropyl)furo[3,2-c]pyridin-4-amine (PubChem CID 103702592) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is N-(3-cyclopentylpropyl)furo[3,2-c]pyridin-4-amine.
| Compound Name | N-(3-cyclopentylpropyl)furo[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 103702592 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | N-(3-cyclopentylpropyl)furo[3,2-c]pyridin-4-amine |
| SMILES | c1cc2occc2c(NCCCC2CCCC2)n1 |
| InChI | InChI=1S/C15H20N2O/c1-2-5-12(4-1)6-3-9-16-15-13-8-11-18-14(13)7-10-17-15/h7-8,10-12H,1-6,9H2,(H,16,17) |
| InChIKey | FFYUIVOWEVNCOU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|