About N-cyclohexylfuro[3,2-c]pyridin-4-amine
N-cyclohexylfuro[3,2-c]pyridin-4-amine (PubChem CID 103702450) has the molecular formula C13H16N2O
and a molecular weight of 216.28 g/mol. Its IUPAC name is N-cyclohexylfuro[3,2-c]pyridin-4-amine.
Molecular Properties
| Compound Name | N-cyclohexylfuro[3,2-c]pyridin-4-amine |
| PubChem CID | 103702450 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | N-cyclohexylfuro[3,2-c]pyridin-4-amine |
| SMILES | c1cc2occc2c(NC2CCCCC2)n1 |
| InChI | InChI=1S/C13H16N2O/c1-2-4-10(5-3-1)15-13-11-7-9-16-12(11)6-8-14-13/h6-10H,1-5H2,(H,14,15) |
| InChIKey | VHIMKFVHBKAXFY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclohexylfuro[3,2-c]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexylfuro[3,2-c]pyridin-4-amine?
The IUPAC name of N-cyclohexylfuro[3,2-c]pyridin-4-amine (CID 103702450) is N-cyclohexylfuro[3,2-c]pyridin-4-amine.
What is the SMILES notation for N-cyclohexylfuro[3,2-c]pyridin-4-amine?
The canonical SMILES for N-cyclohexylfuro[3,2-c]pyridin-4-amine is c1cc2occc2c(NC2CCCCC2)n1.
What is the InChIKey of N-cyclohexylfuro[3,2-c]pyridin-4-amine?
The InChIKey is VHIMKFVHBKAXFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O/c1-2-4-10(5-3-1)15-13-11-7-9-16-12(11)6-8-14-13/h6-10H,1-5H2,(H,14,15).
What are the key properties of N-cyclohexylfuro[3,2-c]pyridin-4-amine?
N-cyclohexylfuro[3,2-c]pyridin-4-amine has a molecular weight of 216.28 g/mol, XLogP of 3.57, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexylfuro[3,2-c]pyridin-4-amine is sourced from PubChem (CID 103702450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).