C13H16N2O — CID 103702450
N-cyclohexylfuro[3,2-c]pyridin-4-amine (PubChem CID 103702450) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is N-cyclohexylfuro[3,2-c]pyridin-4-amine.
| Compound Name | N-cyclohexylfuro[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 103702450 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | N-cyclohexylfuro[3,2-c]pyridin-4-amine |
| SMILES | c1cc2occc2c(NC2CCCCC2)n1 |
| InChI | InChI=1S/C13H16N2O/c1-2-4-10(5-3-1)15-13-11-7-9-16-12(11)6-8-14-13/h6-10H,1-5H2,(H,14,15) |
| InChIKey | VHIMKFVHBKAXFY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |