C14H18N2O — CID 113241370
N-(3-methylcyclohexyl)furo[3,2-c]pyridin-4-amine (PubChem CID 113241370) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is N-(3-methylcyclohexyl)furo[3,2-c]pyridin-4-amine.
| Compound Name | N-(3-methylcyclohexyl)furo[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 113241370 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | N-(3-methylcyclohexyl)furo[3,2-c]pyridin-4-amine |
| SMILES | CC1CCCC(Nc2nccc3occc23)C1 |
| InChI | InChI=1S/C14H18N2O/c1-10-3-2-4-11(9-10)16-14-12-6-8-17-13(12)5-7-15-14/h5-8,10-11H,2-4,9H2,1H3,(H,15,16) |
| InChIKey | SJSLODYPPSICDB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |