C11H11N3O2 — CID 107143780
4-(furo[3,2-c]pyridin-4-ylamino)pyrrolidin-2-one (PubChem CID 107143780) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is 4-(furo[3,2-c]pyridin-4-ylamino)pyrrolidin-2-one.
| Compound Name | 4-(furo[3,2-c]pyridin-4-ylamino)pyrrolidin-2-one |
|---|---|
| PubChem CID | 107143780 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 4-(furo[3,2-c]pyridin-4-ylamino)pyrrolidin-2-one |
| SMILES | O=C1CC(Nc2nccc3occc23)CN1 |
| InChI | InChI=1S/C11H11N3O2/c15-10-5-7(6-13-10)14-11-8-2-4-16-9(8)1-3-12-11/h1-4,7H,5-6H2,(H,12,14)(H,13,15) |
| InChIKey | DVIYBRWFNLOPOM-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |