C10H12N4O2 — CID 107143766
2-[(5-oxopyrrolidin-3-yl)amino]pyridine-3-carboxamide (PubChem CID 107143766) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is 2-[(5-oxopyrrolidin-3-yl)amino]pyridine-3-carboxamide.
| Compound Name | 2-[(5-oxopyrrolidin-3-yl)amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 107143766 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 2-[(5-oxopyrrolidin-3-yl)amino]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cccnc1NC1CNC(=O)C1 |
| InChI | InChI=1S/C10H12N4O2/c11-9(16)7-2-1-3-12-10(7)14-6-4-8(15)13-5-6/h1-3,6H,4-5H2,(H2,11,16)(H,12,14)(H,13,15) |
| InChIKey | KRMYVZQGHMVFLP-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |