C8H10ClN5O — CID 106182693
4-[(5-amino-6-chloropyrimidin-4-yl)amino]pyrrolidin-2-one (PubChem CID 106182693) has the molecular formula C8H10ClN5O and a molecular weight of 227.66 g/mol. Its IUPAC name is 4-[(5-amino-6-chloropyrimidin-4-yl)amino]pyrrolidin-2-one.
| Compound Name | 4-[(5-amino-6-chloropyrimidin-4-yl)amino]pyrrolidin-2-one |
|---|---|
| PubChem CID | 106182693 |
| Molecular Formula | C8H10ClN5O |
| Molecular Weight | 227.66 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 4-[(5-amino-6-chloropyrimidin-4-yl)amino]pyrrolidin-2-one |
| SMILES | Nc1c(Cl)ncnc1NC1CNC(=O)C1 |
| InChI | InChI=1S/C8H10ClN5O/c9-7-6(10)8(13-3-12-7)14-4-1-5(15)11-2-4/h3-4H,1-2,10H2,(H,11,15)(H,12,13,14) |
| InChIKey | WQFNBDIYIBQTBS-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.66 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |