C8H10FN5O — CID 106198376
4-[(2-amino-5-fluoropyrimidin-4-yl)amino]pyrrolidin-2-one (PubChem CID 106198376) has the molecular formula C8H10FN5O and a molecular weight of 211.20 g/mol. Its IUPAC name is 4-[(2-amino-5-fluoropyrimidin-4-yl)amino]pyrrolidin-2-one.
| Compound Name | 4-[(2-amino-5-fluoropyrimidin-4-yl)amino]pyrrolidin-2-one |
|---|---|
| PubChem CID | 106198376 |
| Molecular Formula | C8H10FN5O |
| Molecular Weight | 211.20 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 4-[(2-amino-5-fluoropyrimidin-4-yl)amino]pyrrolidin-2-one |
| SMILES | Nc1ncc(F)c(NC2CNC(=O)C2)n1 |
| InChI | InChI=1S/C8H10FN5O/c9-5-3-12-8(10)14-7(5)13-4-1-6(15)11-2-4/h3-4H,1-2H2,(H,11,15)(H3,10,12,13,14) |
| InChIKey | JMOQDAJPTIIJCG-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.20 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |