C8H12N6O — CID 106198877
4-[(2-hydrazinylpyrimidin-4-yl)amino]pyrrolidin-2-one (PubChem CID 106198877) has the molecular formula C8H12N6O and a molecular weight of 208.22 g/mol. Its IUPAC name is 4-[(2-hydrazinylpyrimidin-4-yl)amino]pyrrolidin-2-one.
| Compound Name | 4-[(2-hydrazinylpyrimidin-4-yl)amino]pyrrolidin-2-one |
|---|---|
| PubChem CID | 106198877 |
| Molecular Formula | C8H12N6O |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 4-[(2-hydrazinylpyrimidin-4-yl)amino]pyrrolidin-2-one |
| SMILES | NNc1nccc(NC2CNC(=O)C2)n1 |
| InChI | InChI=1S/C8H12N6O/c9-14-8-10-2-1-6(13-8)12-5-3-7(15)11-4-5/h1-2,5H,3-4,9H2,(H,11,15)(H2,10,12,13,14) |
| InChIKey | ALAZNYHMGHKAKL-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|