C9H12N6O3 — CID 106198856
4-[(6-hydrazinyl-3-nitro-2-pyridinyl)amino]pyrrolidin-2-one (PubChem CID 106198856) has the molecular formula C9H12N6O3 and a molecular weight of 252.23 g/mol. Its IUPAC name is 4-[(6-hydrazinyl-3-nitro-2-pyridinyl)amino]pyrrolidin-2-one.
| Compound Name | 4-[(6-hydrazinyl-3-nitro-2-pyridinyl)amino]pyrrolidin-2-one |
|---|---|
| PubChem CID | 106198856 |
| Molecular Formula | C9H12N6O3 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 4-[(6-hydrazinyl-3-nitro-2-pyridinyl)amino]pyrrolidin-2-one |
| SMILES | NNc1ccc([N+](=O)[O-])c(NC2CNC(=O)C2)n1 |
| InChI | InChI=1S/C9H12N6O3/c10-14-7-2-1-6(15(17)18)9(13-7)12-5-3-8(16)11-4-5/h1-2,5H,3-4,10H2,(H,11,16)(H2,12,13,14) |
| InChIKey | GPZPWBCFURATMI-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 135.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|