C8H8ClN5O3 — CID 106192268
4-[(6-chloro-5-nitropyrimidin-4-yl)amino]pyrrolidin-2-one (PubChem CID 106192268) has the molecular formula C8H8ClN5O3 and a molecular weight of 257.64 g/mol. Its IUPAC name is 4-[(6-chloro-5-nitropyrimidin-4-yl)amino]pyrrolidin-2-one.
| Compound Name | 4-[(6-chloro-5-nitropyrimidin-4-yl)amino]pyrrolidin-2-one |
|---|---|
| PubChem CID | 106192268 |
| Molecular Formula | C8H8ClN5O3 |
| Molecular Weight | 257.64 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 4-[(6-chloro-5-nitropyrimidin-4-yl)amino]pyrrolidin-2-one |
| SMILES | O=C1CC(Nc2ncnc(Cl)c2[N+](=O)[O-])CN1 |
| InChI | InChI=1S/C8H8ClN5O3/c9-7-6(14(16)17)8(12-3-11-7)13-4-1-5(15)10-2-4/h3-4H,1-2H2,(H,10,15)(H,11,12,13) |
| InChIKey | ZULMPJFBMDBJTQ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.64 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|