C8H8ClN7O2 — CID 113413154
6-chloro-5-nitro-N-[2-(triazol-1-yl)ethyl]pyrimidin-4-amine (PubChem CID 113413154) has the molecular formula C8H8ClN7O2 and a molecular weight of 269.65 g/mol. Its IUPAC name is 6-chloro-5-nitro-N-[2-(triazol-1-yl)ethyl]pyrimidin-4-amine.
| Compound Name | 6-chloro-5-nitro-N-[2-(triazol-1-yl)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 113413154 |
| Molecular Formula | C8H8ClN7O2 |
| Molecular Weight | 269.65 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 6-chloro-5-nitro-N-[2-(triazol-1-yl)ethyl]pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(Cl)ncnc1NCCn1ccnn1 |
| InChI | InChI=1S/C8H8ClN7O2/c9-7-6(16(17)18)8(12-5-11-7)10-1-3-15-4-2-13-14-15/h2,4-5H,1,3H2,(H,10,11,12) |
| InChIKey | VPRKAIKQINUJDS-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.65 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|