C11H13ClN6O2 — CID 115991394
6-chloro-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-5-nitropyrimidin-4-amine (PubChem CID 115991394) has the molecular formula C11H13ClN6O2 and a molecular weight of 296.72 g/mol. Its IUPAC name is 6-chloro-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-5-nitropyrimidin-4-amine.
| Compound Name | 6-chloro-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 115991394 |
| Molecular Formula | C11H13ClN6O2 |
| Molecular Weight | 296.72 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 6-chloro-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-5-nitropyrimidin-4-amine |
| SMILES | CCc1nn(C)cc1CNc1ncnc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13ClN6O2/c1-3-8-7(5-17(2)16-8)4-13-11-9(18(19)20)10(12)14-6-15-11/h5-6H,3-4H2,1-2H3,(H,13,14,15) |
| InChIKey | WYHFDGKZNQZJQE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.72 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|