C10H13N7O2 — CID 112672278
4-N-[(1,3-dimethylpyrazol-4-yl)methyl]-5-nitropyrimidine-4,6-diamine (PubChem CID 112672278) has the molecular formula C10H13N7O2 and a molecular weight of 263.26 g/mol. Its IUPAC name is 4-N-[(1,3-dimethylpyrazol-4-yl)methyl]-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-[(1,3-dimethylpyrazol-4-yl)methyl]-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112672278 |
| Molecular Formula | C10H13N7O2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 4-N-[(1,3-dimethylpyrazol-4-yl)methyl]-5-nitropyrimidine-4,6-diamine |
| SMILES | Cc1nn(C)cc1CNc1ncnc(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H13N7O2/c1-6-7(4-16(2)15-6)3-12-10-8(17(18)19)9(11)13-5-14-10/h4-5H,3H2,1-2H3,(H3,11,12,13,14) |
| InChIKey | KSZCJRBUPQQKGK-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|