C9H10N6O2S — CID 80807868
4-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-5-nitropyrimidine-4,6-diamine (PubChem CID 80807868) has the molecular formula C9H10N6O2S and a molecular weight of 266.29 g/mol. Its IUPAC name is 4-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80807868 |
| Molecular Formula | C9H10N6O2S |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 4-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-5-nitropyrimidine-4,6-diamine |
| SMILES | Cc1nc(CNc2ncnc(N)c2[N+](=O)[O-])cs1 |
| InChI | InChI=1S/C9H10N6O2S/c1-5-14-6(3-18-5)2-11-9-7(15(16)17)8(10)12-4-13-9/h3-4H,2H2,1H3,(H3,10,11,12,13) |
| InChIKey | LOUFCRUURKMTMT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 119.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|