C20H16N6O2S — CID 108775791
5-nitro-4-N-[[3-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]pyrimidine-4,6-diamine (PubChem CID 108775791) has the molecular formula C20H16N6O2S and a molecular weight of 404.46 g/mol. Its IUPAC name is 5-nitro-4-N-[[3-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]pyrimidine-4,6-diamine.
| Compound Name | 5-nitro-4-N-[[3-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 108775791 |
| Molecular Formula | C20H16N6O2S |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 5-nitro-4-N-[[3-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]pyrimidine-4,6-diamine |
| SMILES | Nc1ncnc(NCc2cccc(-c3nc(-c4ccccc4)cs3)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H16N6O2S/c21-18-17(26(27)28)19(24-12-23-18)22-10-13-5-4-8-15(9-13)20-25-16(11-29-20)14-6-2-1-3-7-14/h1-9,11-12H,10H2,(H3,21,22,23,24) |
| InChIKey | HORJKKPUHKOMPC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 119.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|