C25H19N3O3S — CID 108738487
(E)-3-(4-nitrophenyl)-N-[[3-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]prop-2-enamide (PubChem CID 108738487) has the molecular formula C25H19N3O3S and a molecular weight of 441.51 g/mol. Its IUPAC name is (E)-3-(4-nitrophenyl)-N-[[3-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(4-nitrophenyl)-N-[[3-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 108738487 |
| Molecular Formula | C25H19N3O3S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | (E)-3-(4-nitrophenyl)-N-[[3-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)NCc1cccc(-c2nc(-c3ccccc3)cs2)c1 |
| InChI | InChI=1S/C25H19N3O3S/c29-24(14-11-18-9-12-22(13-10-18)28(30)31)26-16-19-5-4-8-21(15-19)25-27-23(17-32-25)20-6-2-1-3-7-20/h1-15,17H,16H2,(H,26,29)/b14-11+ |
| InChIKey | KURPJNSLNSQKNZ-SDNWHVSQSA-N |
| XLogP | 5.71 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|