C22H18ClN5O4S — CID 108771401
6-chloro-N-[[4-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]phenyl]methyl]-5-nitropyrimidin-4-amine (PubChem CID 108771401) has the molecular formula C22H18ClN5O4S and a molecular weight of 483.94 g/mol. Its IUPAC name is 6-chloro-N-[[4-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]phenyl]methyl]-5-nitropyrimidin-4-amine.
| Compound Name | 6-chloro-N-[[4-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]phenyl]methyl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 108771401 |
| Molecular Formula | C22H18ClN5O4S |
| Molecular Weight | 483.94 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | 6-chloro-N-[[4-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]phenyl]methyl]-5-nitropyrimidin-4-amine |
| SMILES | COc1ccc(-c2csc(-c3ccc(CNc4ncnc(Cl)c4[N+](=O)[O-])cc3)n2)cc1OC |
| InChI | InChI=1S/C22H18ClN5O4S/c1-31-17-8-7-15(9-18(17)32-2)16-11-33-22(27-16)14-5-3-13(4-6-14)10-24-21-19(28(29)30)20(23)25-12-26-21/h3-9,11-12H,10H2,1-2H3,(H,24,25,26) |
| InChIKey | IQHLOLXVXJQCOF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.94 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|