C20H15ClN6O4S — CID 4236714
6-(4-chloro-2-methoxyphenoxy)-5-nitro-N-[[4-(thiadiazol-4-yl)phenyl]methyl]pyrimidin-4-amine (PubChem CID 4236714) has the molecular formula C20H15ClN6O4S and a molecular weight of 470.90 g/mol. Its IUPAC name is 6-(4-chloro-2-methoxyphenoxy)-5-nitro-N-[[4-(thiadiazol-4-yl)phenyl]methyl]pyrimidin-4-amine.
| Compound Name | 6-(4-chloro-2-methoxyphenoxy)-5-nitro-N-[[4-(thiadiazol-4-yl)phenyl]methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 4236714 |
| Molecular Formula | C20H15ClN6O4S |
| Molecular Weight | 470.90 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | 6-(4-chloro-2-methoxyphenoxy)-5-nitro-N-[[4-(thiadiazol-4-yl)phenyl]methyl]pyrimidin-4-amine |
| SMILES | COc1cc(Cl)ccc1Oc1ncnc(NCc2ccc(-c3csnn3)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H15ClN6O4S/c1-30-17-8-14(21)6-7-16(17)31-20-18(27(28)29)19(23-11-24-20)22-9-12-2-4-13(5-3-12)15-10-32-26-25-15/h2-8,10-11H,9H2,1H3,(H,22,23,24) |
| InChIKey | QNVSMSQRAFCGDT-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.90 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|