C21H14N6O3S — CID 4236718
6-(3-ethynylphenoxy)-5-nitro-N-[[4-(thiadiazol-4-yl)phenyl]methyl]pyrimidin-4-amine (PubChem CID 4236718) has the molecular formula C21H14N6O3S and a molecular weight of 430.45 g/mol. Its IUPAC name is 6-(3-ethynylphenoxy)-5-nitro-N-[[4-(thiadiazol-4-yl)phenyl]methyl]pyrimidin-4-amine.
| Compound Name | 6-(3-ethynylphenoxy)-5-nitro-N-[[4-(thiadiazol-4-yl)phenyl]methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 4236718 |
| Molecular Formula | C21H14N6O3S |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 6-(3-ethynylphenoxy)-5-nitro-N-[[4-(thiadiazol-4-yl)phenyl]methyl]pyrimidin-4-amine |
| SMILES | C#Cc1cccc(Oc2ncnc(NCc3ccc(-c4csnn4)cc3)c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H14N6O3S/c1-2-14-4-3-5-17(10-14)30-21-19(27(28)29)20(23-13-24-21)22-11-15-6-8-16(9-7-15)18-12-31-26-25-18/h1,3-10,12-13H,11H2,(H,22,23,24) |
| InChIKey | SZMOJYJAGGNGCO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 115.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|