C11H12N6O2 — CID 80831700
4-N-[(6-methyl-3-pyridinyl)methyl]-5-nitropyrimidine-4,6-diamine (PubChem CID 80831700) has the molecular formula C11H12N6O2 and a molecular weight of 260.26 g/mol. Its IUPAC name is 4-N-[(6-methyl-3-pyridinyl)methyl]-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-[(6-methyl-3-pyridinyl)methyl]-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80831700 |
| Molecular Formula | C11H12N6O2 |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 4-N-[(6-methyl-3-pyridinyl)methyl]-5-nitropyrimidine-4,6-diamine |
| SMILES | Cc1ccc(CNc2ncnc(N)c2[N+](=O)[O-])cn1 |
| InChI | InChI=1S/C11H12N6O2/c1-7-2-3-8(4-13-7)5-14-11-9(17(18)19)10(12)15-6-16-11/h2-4,6H,5H2,1H3,(H3,12,14,15,16) |
| InChIKey | BKJIPLGHEKVRNS-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 119.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|