C14H14F3N5O4 — CID 133444905
N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-2,6-dinitro-4-(trifluoromethyl)aniline (PubChem CID 133444905) has the molecular formula C14H14F3N5O4 and a molecular weight of 373.29 g/mol. Its IUPAC name is N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-2,6-dinitro-4-(trifluoromethyl)aniline.
| Compound Name | N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-2,6-dinitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 133444905 |
| Molecular Formula | C14H14F3N5O4 |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-2,6-dinitro-4-(trifluoromethyl)aniline |
| SMILES | CCc1nn(C)cc1CNc1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H14F3N5O4/c1-3-10-8(7-20(2)19-10)6-18-13-11(21(23)24)4-9(14(15,16)17)5-12(13)22(25)26/h4-5,7,18H,3,6H2,1-2H3 |
| InChIKey | PIYSLMKHGRKDLI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 116.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|