C12H16N4O4S2 — CID 133444874
N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-5-methylsulfonyl-3-nitrothiophen-2-amine (PubChem CID 133444874) has the molecular formula C12H16N4O4S2 and a molecular weight of 344.42 g/mol. Its IUPAC name is N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-5-methylsulfonyl-3-nitrothiophen-2-amine.
| Compound Name | N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-5-methylsulfonyl-3-nitrothiophen-2-amine |
|---|---|
| PubChem CID | 133444874 |
| Molecular Formula | C12H16N4O4S2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-5-methylsulfonyl-3-nitrothiophen-2-amine |
| SMILES | CCc1nn(C)cc1CNc1sc(S(C)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H16N4O4S2/c1-4-9-8(7-15(2)14-9)6-13-12-10(16(17)18)5-11(21-12)22(3,19)20/h5,7,13H,4,6H2,1-3H3 |
| InChIKey | PYVCNOCCUPZDHU-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|